Asam flufenamat

Dari Wikipedia bahasa Indonesia, ensiklopedia bebas
Jump to navigation Jump to search

{{Drugbox | verifiedrevid = 407643332 | IUPAC_name = 2-{[3-(Trifluoromethyl)phenyl]amino}benzoic acid | image = flufenamic acid.png | image2 = Flufenamic acid-3D-balls.png | CASNo_Ref =  YaY | ChemSpiderID_Ref =  YaY | ChemSpiderID = 3254 | UNII_Ref =  YaY | UNII = 60GCX7Y6BH | InChI = 1/C14H10F3NO2/c15-14(16,17)9-4-3-5-10(8-9)18-12-7-2-1-6-11(12)13(19)20/h1-8,18H,(H,19,20) | InChIKey = LPEPZBJOKDYZAD-UHFFFAOYAI | ChEMBL_Ref =  YaY | ChEMBL = 23588 | StdInChI_Ref =  YaY | StdInChI = 1S/C14H10F3NO2/c15-14(16,17)9-4-3-5-10(8-9)18-12-7-2-1-6-11(12)13(19)20/h1-8,18H,(H,19,20) | StdInChIKey_Ref =  YaY | StdInChIKey = LPEPZBJOKDYZAD-UHFFFAOYSA-N | CAS_number = 530-78-9 | ATC_prefix = M01 | ATC_suffix = AG03 | PubChem = 3371 | IUPHAR_ligand = 2447 | DrugBank = | KEGG_Ref =  YaY | KEGG = D01581 | smiles = FC(F)(F)c1cc(ccc1)Nc2ccccc2C(=O)O | C=14|H=10|F=3|N=1|O=2 | molecular_weight = 281.22991 g/mol | melting_point = 124 | melting_high = 125 | melting_notes = resolidification and remelting at 134 °C to 136 °C | solubility = Practically insoluble in water; soluble in ethanol, chloroform and diethyl ether | bioavailability = | protein_bound = extensively | metabolism = Hydroxylation, glucuronidation | elimination_half-life = ~3 h | excretion = 50% urine, 36% feces | pregnancy_AU = | pregnancy_US = | pregnancy_category= | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration = oral, topical }} Asam flufenamat (bahasa Inggris: flufenamic acid, FLF) adalah senyawa organik nonsteroid dari golongan asam fenamat yang bersifat anti-peradangan. Asam flufenamat telah lama digunakan untuk menghambat terserapnya ion Ca2+ melalui transient receptor potential channels (TRPC), dan menginduksi pelepasan Ca2+ dari mitokondria.[1] Selain itu, FLF juga menghambat transkripsi reseptor androgen dan memberi pengaruh genetik terhadap gen pencerap tersebut.[2]

Rujukan[sunting | sunting sumber]

  1. ^ (Inggris)"Functional distinctions in cytosolic calcium regulation between cells of the glomerular filtration barrier". Academic Renal Unit, Southmead Hospital, Microvascular Research Laboratories, Department of Physiology, University of Bristol; Rebecca Rachael Foster, Gavin I. Welsh, Simon C. Satchell, Robin D. Marlow, Mathew D. Wherlock, Debora Pons, Peter W. Mathieson, David O. Bates, dan Moin A. Saleem. Diakses tanggal 2011-06-08. 
  2. ^ (Inggris)"Novel Flufenamic Acid Analogs as Inhibitors of Androgen Receptor Mediated Transcription". Department of Chemical Biology and Therapeutics, St Jude Children's Research Hospital; Clémentine Féau, Leggy A. Arnold, Aaron Kosinski, Fangyi Zhu, Michele Connelly, dan R. Kiplin Guy. Diakses tanggal 2011-06-08.