Koenzim A

Dari Wikipedia bahasa Indonesia, ensiklopedia bebas
Lompat ke: navigasi, cari
Koenzim A
Nomor CAS [85-61-0]
PubChem 6816
DrugBank DB01992
KEGG C00010
MeSH Coenzyme+A
SMILES O=C(NCCS)CCNC(=O)C(O)C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@H]3O[C@@H](n2cnc1c(ncnc12)N)[C@H](O)[C@@H]3OP(=O)(O)O
InChI 1/C21H36N7O16P3S/c1-21(2,16(31)19(32)24-4-3-12(29)23-5-6-48)8-41-47(38,39)44-46(36,37)40-7-11-15(43-45(33,34)35)14(30)20(42-11)28-10-27-13-17(22)25-9-26-18(13)28/h9-11,14-16,20,30-31,48H,3-8H2,1-2H3,(H,23,29)(H,24,32)(H,36,37)(H,38,39)(H2,22,25,26)(H2,33,34,35)/t11-,14-,15-,16?,20-/m1/s1
Rumus molekul C21H36N7O16P3S
Massa molar 767.535
Kecuali dinyatakan sebaliknya, data di atas berlaku
pada temperatur dan tekanan standar (25°C, 100 kPa)

Sangkalan dan referensi

Koenzim A, KoA (bahasa Inggris: coenzyme A, CoA, CoASH, HSCoA) adalah sebuah kofaktor yang dikenal karena berperan dalam sintesis dan oksidasi asam lemak, serta oksidasi asam piruvat dalam siklus asam sitrat. Semua lintasan biologis yang melibatkan enzim, ternyata juga memerlukan koenzim A sebagai substrat. Sebagai contoh: substrat tioester seperti asetil-KoA pada sintesis sisteamina, asam pantotenat, dan adenosin trifosfat (ATP).

Biosintesis[sunting | sunting sumber]

Koenzim A disintesis dari pantotenat melalui lima langkah

  1. Pantotenat difosforilasi menjadi 4'-fosfopantotenat oleh enzim pantotenat kinase
  2. Sebuah sistein ditambahkan pada 4'-fosfopantotenat oleh enzim fosfopantotenoilsistein sintetase membentuk 4'-fosfo-N-pantotenoilsistein (PPC)
  3. PPC di-dekarboksilasi menjadi 4'-fosfopantetein oleh enzim fosfopantotenoilsistein dekarboksilase
  4. 4'-fosfopantetein di adenililasi membentuk defosfo-CoA oleh enzim fosfopantetein adenilil transerase
  5. Akhirnya, defosfo-CoA di-fosforilasi dengan ATP menjadi koenzim A melalui defosfokoenzim A kinase

Fungsi[sunting | sunting sumber]

Secara kimia, koenzim A merupakan sebuah tiol, sehingga ia mampu bereaksi dengan asam karboksilat membentuk tioester. Hal ini berarti koenzim A dapat berfungsi sebagai pembawa gugus asil. Molekul koenzim A yang membawa gugus asetil disebut asetil-KoA. Jika tidak terikat pada gugus asil apapun, ia biasa disebut 'CoASH' or 'HSCoA'.

Daftar gugus asil yang diaktivasi oleh koenzim A[sunting | sunting sumber]

Referensi[sunting | sunting sumber]