Isopentenil Pirofosfat

Dari Wikipedia bahasa Indonesia, ensiklopedia bebas
Langsung ke: navigasi, cari
Isopentenil Pirofosfat
Gambar
Gambar
Identifikasi
Nomor CAS [358-71-4]
PubChem 15983957
MeSH isopentenyl+pyrophosphate
SMILES CC(=C)CCOP(=O)([O-])OP(=O)([O-])[O-]
InChI 1/C5H12O7P2/c1-5(2)3-4-11-14(9,10)12-13(6,7)8/h1,3-4H2,2H3,(H,9,10)(H2,6,7,8)/p-3
Sifat
Rumus molekul C5H12O7P2
Kecuali dinyatakan sebaliknya, data di atas berlaku
pada temperatur dan tekanan standar (25°C, 100 kPa)

Sangkalan dan referensi

Isopentenil Pirofosfat (IPP), adalah intermediat dalam biosintesis senyawa-senyawa terpena. IPP adalah isomer dari DMAPP. IPP bersama DMAPP adalah C-5, isoprena aktif yang membuktikan bahwa senyawa-senyawa terpena adalah senyawa dengan jumlah karbon kelipatan lima.