Laktosa: Perbedaan revisi

Loncat ke navigasi Loncat ke pencarian
2.729 bita ditambahkan ,  8 tahun yang lalu
tidak ada ringkasan suntingan
k (r2.7.1) (bot Menambah: be-x-old:Ляктоза)
{{chembox
[[Berkas:Beta-D-Lactose.svg|200px|thumb|Molekul laktosa]]
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 400128939
| Name = Laktosa (Gula susu)
| ImageFile = Beta-D-Lactose.svg
| ImageSize = 300px
| IUPACName = β-<small>D</small>-galactopyranosyl-(1→4)-<small>D</small>-glucose
| OtherNames = Gula susu<br/>4-''O''-β-<small>D</small>-galaktopiranosil<small>D</small>-glukosa
| Section1 = {{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 5904
| InChI = 1/C12H22O11/c13-1-3-5(15)6(16)9(19)12(22-3)23-10-4(2-14)21-11(20)8(18)7(10)17/h3-20H,1-2H2/t3-,4-,5+,6+,7-,8-,9-,10-,11-,12+/m1/s1
| InChIKey = GUBGYTABKSRVRQ-DCSYEGIMBP
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C12H22O11/c13-1-3-5(15)6(16)9(19)12(22-3)23-10-4(2-14)21-11(20)8(18)7(10)17/h3-20H,1-2H2/t3-,4-,5+,6+,7-,8-,9-,10-,11-,12+/m1/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = GUBGYTABKSRVRQ-DCSYEGIMSA-N
| CASNo = 63-42-3
| CASNo_Ref = {{cascite|correct|CAS}}
| EC-number = 200-559-2
| PubChem = 6134
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 1159651
| UNII_Ref = {{fdacite|changed|FDA}}
| UNII = J2B2A4N98G
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 36218
| SMILES = C([C@@H]1[C@@H]([C@@H]([C@H]([C@@H](O1)O[C@@H]2[C@H](O[C@H]([C@@H]([C@H]2O)O)O)CO)O)O)O)O
}}
| Section2 = {{Chembox Properties
| Formula = C<sub>12</sub>H<sub>22</sub>O<sub>11</sub>
| MolarMass = 342.30 g/mol
| Appearance = padatan putih
| Density = 1.525 g/cm<sup>3</sup>
| MeltingPt = 202.8&nbsp;°C<ref name=Ald>Anonymous. Sigma Aldrich. Lactose Product. http://www.sigmaaldrich.com/catalog/ProductDetail.do?lang=en&N4=17814|FLUKA&N5=SEARCH_CONCAT_PNO|BRAND_KEY&F=SPEC St. Louis MO.</ref>
| BoilingPt = 668.9&nbsp;°C<ref name=Ald/>
| Solubility = 21.6 g/100 mL<ref>Kelarutan laktosa dalam air adalah 18.9049&nbsp;g pada suhu 25&nbsp;°C, 25.1484&nbsp;g pada suhu 40&nbsp;°C dan 37.2149&nbsp;g pada suhu 60&nbsp;°C per 100&nbsp;g campuran. Kelarutannya dalam [[etanol]] adalah 0.0111&nbsp;g pada suhu 40&nbsp;°C dan 0.0270&nbsp;g pada suhu 60&nbsp;°C per 100&nbsp;g campuran.{{citation | year = 2001 | last1 = Machado | first1 = José J. B. | first2 = João A. | last2 = Coutinho | first3 = Eugénia A. | last3 = Macedo | title = Solid–liquid equilibrium of α-lactose in ethanol/water | url = http://path.web.ua.pt/file/FPE%20(2000)%20173%20121.pdf | journal = Fluid Phase Equilibria | volume = 173 | issue = 1 | pages = 121–34 | doi = 10.1016/S0378-3812(00)00388-5}}.
ds</ref>
}}
| Section4 = {{Chembox Thermochemistry| DeltaHc = 5652 kJ/mol, 1351 kcal/mol, 16.5 kJ/g, 3.94 kcal/g}}
| Section7 = {{Chembox Hazards
| EUIndex = tidak tercantum
| FlashPt = 357.8&nbsp;°C<ref name="Ald"/>
| Autoignition =
}}
}}
'''Laktosa''' adalah bentuk [[disakarida]] dari [[karbohidrat]] yang dapat dipecah menjadi bentuk lebih sederhana yaitu [[galaktosa]] dan [[glukosa]]. Laktosa ada di dalam kandungan [[susu]], dan merupakan 2-8 persen bobot susu keseluruhan.
 

Menu navigasi