Anisatin

Dari Wikipedia bahasa Indonesia, ensiklopedia bebas
Lompat ke: navigasi, cari
Anisatin
Gambar
Identifikasi
Nomor CAS [5230-87-5]
PubChem 12306850
KEGG C09294
MeSH Anisatin
SMILES O=C1OC[C@]14[C@@]2(O)[C@H](O)C[C@H]([C@]23C[C@@H](OC(=O)[C@@H]3O)[C@@]4(O)C)C
3DMet B05347
Sifat
Rumus kimia C15H20O8
Massa molar 328.31 g mol−1
log P -1.894
Keasaman (pKa) 12.005
Kebasaan (pKb) 1.992
Kecuali dinyatakan sebaliknya, data di atas berlaku
pada temperatur dan tekanan standar (25°C, 100 kPa)

Sangkalan dan referensi

Anisatin adalah zat beracun yang merupakan komponen aktif pada tumbuhan Shikimi.

Referensi[sunting | sunting sumber]