Benziltrimetilamonium fluorida

Dari Wikipedia bahasa Indonesia, ensiklopedia bebas
Langsung ke: navigasi, cari
Benziltrimetilamonium fluorida[1]
Gambar
Identifikasi
Singkatan BTAF
Nomor CAS
PubChem 16211989
Nomor EINECS 233-892-7
SMILES C[N+](C)(C)CC1=CC=CC=C1.O.[F-]
InChI InChI=1/C10H16N.FH.H2O/c1-11(2,3)9-10-7-5-4-6-8-10;;/h4-8H,9H2,1-3H3;1H;1H2/q+1;;/p-1/fC10H16N.F.H2O/h;1h;/qm;-1;
Sifat
Rumus molekul C10H18F1N1O1
Massa molar 187,25 g/mol
Penampilan Padat
Titik lebur
(untuk senyawa hidrat)
Bahaya
Klasifikasi EU Irritan (Xi)
Frasa-R R36/37/38
Frasa-S S26 S37/39
Kecuali dinyatakan sebaliknya, data di atas berlaku
pada temperatur dan tekanan standar (25°C, 100 kPa)

Sangkalan dan referensi

Benziltrimetilamonium fluorida adalah garam amonia kuaterner. Ia secara komersial tersedia sebagai hidrat. Senyawa ini merupakan sumber ion fluorida yang larut dalam larutan organik. Ia digunakan untuk melepaskan gugus pelindung silil eter.

Referensi[sunting | sunting sumber]