Prednison: Perbedaan antara revisi
WanaraLima (bicara | kontrib) Artikel baru tentang topik farmasi yang masih memerlukan tambahan dan pengembangan |
WanaraLima (bicara | kontrib) Tidak ada ringkasan suntingan Tag: Suntingan visualeditor-wikitext |
||
Baris 1: | Baris 1: | ||
'''Prednison''' adalah [[obat]] [[kortikosteroid]] yang digunakan untuk mengurangi [[peradangan]] dan digunakan untuk kondisi [[Autoimunitas|autoimun]]. Prednison digunakan untuk mengobati gangguan [[alergi]], kondisi kulit, kolitis ulserativa, penyakit Crohn, radang sendi, lupus, psoriasis, asma, penyakit paru obstruktif kronik (PPOK) dan banyak lagi kondisi lainnya.<ref>{{Cite web|last=https://www.drugs.com/prednisone.html|title=Prednisone Uses, Dosage, Side Effects, Warnings|url=https://www.drugs.com/prednisone.html|website=Drugs.com|language=en|access-date=2023-06-18}}</ref> |
'''Prednison''' adalah [[obat]] [[kortikosteroid]] yang digunakan untuk mengurangi [[peradangan]] dan digunakan untuk kondisi [[Autoimunitas|autoimun]]. Prednison digunakan untuk mengobati gangguan [[alergi]], kondisi kulit, kolitis ulserativa, penyakit Crohn, radang sendi, lupus, psoriasis, asma, penyakit paru obstruktif kronik (PPOK) dan banyak lagi kondisi lainnya.<ref>{{Cite web|last=https://www.drugs.com/prednisone.html|title=Prednisone Uses, Dosage, Side Effects, Warnings|url=https://www.drugs.com/prednisone.html|website=Drugs.com|language=en|access-date=2023-06-18}}</ref> |
||
<!--Clinical data--> |
|||
| tradename = Deltasone, Liquid Pred, Orasone, others |
|||
| Drugs.com = {{drugs.com|monograph|prednisone}} |
|||
| MedlinePlus = a601102 |
|||
| licence_EU = |
|||
| DailyMedID = Prednisone |
|||
| licence_US = |
|||
| pregnancy_AU = A |
|||
| pregnancy_category = |
|||
| routes_of_administration = [[Oral administration|By mouth]] |
|||
| ATC_prefix = A07 |
|||
| ATC_suffix = EA03 |
|||
| ATC_supplemental = {{ATC|H02|AB07}} |
|||
| legal_AU = S4 |
|||
| legal_CA = |
|||
| legal_UK = |
|||
| legal_US = Rx only |
|||
| legal_status = |
|||
<!--Pharmacokinetic data--> |
|||
| bioavailability = 70% |
|||
| metabolism = [[prednisolone]] ([[liver]]) |
|||
| elimination_half-life = 3 to 4 hours in adults. 1 to 2 hours in children<ref name="pmid378499">{{cite journal | vauthors = Pickup ME | title = Clinical pharmacokinetics of prednisone and prednisolone | journal = Clinical Pharmacokinetics | volume = 4 | issue = 2 | pages = 111–128 | date = 1979 | pmid = 378499 | doi = 10.2165/00003088-197904020-00004 | s2cid = 12218704 }}</ref> |
|||
| excretion = Kidney |
|||
<!--Identifiers--> |
|||
| CAS_number = 53-03-2 |
|||
| CAS_number_Ref = {{cascite|correct|??}} |
|||
| PubChem = 5865 |
|||
| IUPHAR_ligand = 7096 |
|||
| DrugBank = DB00635 |
|||
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|||
| ChemSpiderID = 5656 |
|||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|||
| UNII = VB0R961HZT |
|||
| UNII_Ref = {{fdacite|changed|FDA}} |
|||
| KEGG = C07370 |
|||
| KEGG_Ref = {{keggcite|correct|kegg}} |
|||
| ChEBI = 8382 |
|||
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|||
| ChEMBL = 635 |
|||
| synonyms = |
|||
<!--Chemical data--> |
|||
| IUPAC_name = 17,21-dihydroxypregna-1,4-diene-3,11,20-trione |
|||
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|||
| C=21 | H=26 | O=5 |
|||
| StdInChI = 1S/C21H26O5/c1-19-7-5-13(23)9-12(19)3-4-14-15-6-8-21(26,17(25)11-22)20(15,2)10-16(24)18(14)19/h5,7,9,14-15,18,22,26H,3-4,6,8,10-11H2,1-2H3/t14-,15-,18+,19-,20-,21-/m0/s1 |
|||
| StdInChIKey = XOFYZVNMUHMLCC-ZPOLXVRWSA-N |
|||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|||
| verifiedrevid = 464213538 |
|||
| Verifiedfields = changed |
|||
| smiles = O=C(CO)[C@@]3(O)CC[C@H]2[C@@H]4CC\C1=C\C(=O)\C=C/[C@]1(C)[C@H]4C(=O)C[C@@]23C |
|||
}} |
|||
== Referensi == |
== Referensi == |
Revisi per 18 Juni 2023 11.10
Prednison adalah obat kortikosteroid yang digunakan untuk mengurangi peradangan dan digunakan untuk kondisi autoimun. Prednison digunakan untuk mengobati gangguan alergi, kondisi kulit, kolitis ulserativa, penyakit Crohn, radang sendi, lupus, psoriasis, asma, penyakit paru obstruktif kronik (PPOK) dan banyak lagi kondisi lainnya.[1]
| tradename = Deltasone, Liquid Pred, Orasone, others | Drugs.com = monograph | MedlinePlus = a601102 | licence_EU = | DailyMedID = Prednisone | licence_US = | pregnancy_AU = A | pregnancy_category = | routes_of_administration = By mouth | ATC_prefix = A07 | ATC_suffix = EA03 | ATC_supplemental = H02AB07
| legal_AU = S4 | legal_CA = | legal_UK = | legal_US = Rx only | legal_status =
| bioavailability = 70% | metabolism = prednisolone (liver) | elimination_half-life = 3 to 4 hours in adults. 1 to 2 hours in children[2] | excretion = Kidney
| CAS_number = 53-03-2
| CAS_number_Ref =
| PubChem = 5865
| IUPHAR_ligand = 7096
| DrugBank = DB00635
| DrugBank_Ref =
| ChemSpiderID = 5656
| ChemSpiderID_Ref =
| UNII = VB0R961HZT
| UNII_Ref =
| KEGG = C07370
| KEGG_Ref =
| ChEBI = 8382
| ChEBI_Ref =
| ChEMBL = 635
| synonyms =
| IUPAC_name = 17,21-dihydroxypregna-1,4-diene-3,11,20-trione
| ChEMBL_Ref =
| C=21 | H=26 | O=5
| StdInChI = 1S/C21H26O5/c1-19-7-5-13(23)9-12(19)3-4-14-15-6-8-21(26,17(25)11-22)20(15,2)10-16(24)18(14)19/h5,7,9,14-15,18,22,26H,3-4,6,8,10-11H2,1-2H3/t14-,15-,18+,19-,20-,21-/m0/s1
| StdInChIKey = XOFYZVNMUHMLCC-ZPOLXVRWSA-N
| StdInChIKey_Ref =
| StdInChI_Ref =
| verifiedrevid = 464213538
| Verifiedfields = changed
| smiles = O=C(CO)[C@@]3(O)CC[C@H]2[C@@H]4CC\C1=C\C(=O)\C=C/[C@]1(C)[C@H]4C(=O)C[C@@]23C
}}
Referensi
- ^ https://www.drugs.com/prednisone.html. "Prednisone Uses, Dosage, Side Effects, Warnings". Drugs.com (dalam bahasa Inggris). Diakses tanggal 2023-06-18.
- ^ Pickup ME (1979). "Clinical pharmacokinetics of prednisone and prednisolone". Clinical Pharmacokinetics. 4 (2): 111–128. doi:10.2165/00003088-197904020-00004. PMID 378499.