Metilena biru

Dari Wikipedia bahasa Indonesia, ensiklopedia bebas
Lompat ke: navigasi, cari
Metilena biru
Gambar
Gambar
Identifikasi
Nomor CAS 61-73-4
PubChem 6099
ChEBI 6872
ChemSpider 5874
Kode ATC
SMILES CN(C)c1ccc2c(c1)sc-3cc(=[N+](C)C)ccc3n2.[Cl-]
Sifat
Rumus molekul C16H18N3SCl
Massa molar 319.85 g/mol
Titik lebur 100-110 °C (dengan dekomposisi)
Titik didih terdekomposisi
Kecuali dinyatakan lain, data di atas berlaku
pada temperatur dan tekanan standar (25 °C, 100 kPa)

Sangkalan dan referensi

Metilena biru (CI 52015) adalah senyawa kimia aromatik heterosiklik dengan rumus kimia C16H18N3SCl. Senyawa ini banyak digunakan pada bidang biologi dan kimia. Pada suhu ruangan senyawa ini berbentuk padatan, tak berbau, berbentuk bubuk warna hijau tua yang akan menghasilkan larutan warna biru tua bila dilarutkan dalam air. Bentuk hidratnya mengandung 3 molekul air per molekul metilena biru.[1]

Lihat juga[sunting | sunting sumber]

Referensi[sunting | sunting sumber]

Pranala luar[sunting | sunting sumber]