Bleomisin

Dari Wikipedia bahasa Indonesia, ensiklopedia bebas
Loncat ke navigasi Loncat ke pencarian

{{Drugbox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 401932982 | IUPAC_name = (3-{[(2'-{(5S,8S,9S,10R,13S)-15-{6-amino-2- [(1S)-3-amino-1-{[(2S)-2,3-diamino-3-oxopropyl]amino}-3-oxopropyl] -5-methylpyrimidin-4-yl}-13-[{[(2R,3S,4S,5S,6S)-3- {[(2R,3S,4S,5R,6R)-4-(carbamoyloxy)-3,5-dihydroxy-6- (hydroxymethyl)tetrahydro-2H-pyran-2-yl]oxy} -4,5-dihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl]oxy} (1H-imidazol-5-yl)methyl]-9-hydroxy-5-[(1R)-1-hydroxyethyl]-8,10-dimethyl-4,7,12,15-tetraoxo-3,6,11,14-tetraazapentadec-1-yl}-2,4'-bi-1,3-thiazol-4-yl)carbonyl]amino}propyl)(dimethyl)sulfonium | image = Bleomycin A2.svg | caption = Bleomycin A2 | width = 350 | image2 = Bleomycin ball-and-stick.png | width2 = 300 | tradename = Blenoxane | Drugs.com = monograph | MedlinePlus = a682125 | pregnancy_US = D | pregnancy_category = | legal_US = Rx-only | routes_of_administration = intravena, intramuskular, subcutaneous, intrapleural, intratumoral | bioavailability = well absorbed | metabolism = ? | elimination_half-life = 2 jam | excretion = Ginjal (60-70%) | CAS_number_Ref =  YaY | CAS_number = 11056-06-7 | ATC_prefix = L01 | ATC_suffix = DC01 | PubChem = 456190 | DrugBank_Ref =  N | DrugBank = DB00290 | ChemSpiderID_Ref =  YaY | ChemSpiderID = 401687 | UNII_Ref =  YaY | UNII = 40S1VHN69B | KEGG_Ref =  N | KEGG = D07535 | ChEBI_Ref =  N | ChEBI = 22907 | ChEMBL_Ref =  N | ChEMBL = 403664 | C=55 | H=84 | N=17 | O=21 | S=3 | molecular_weight = 1415.551 | smiles = CC1=C(N=C(N=C1N)[C@H](CC(=O)N)NC[C@@H](C(=O)N)N)C(=O)N[C@@H](C(C2=CN=CN2)O[C@H]3[C@H]([C@H]([C@@H]([C@@H](O3)CO)O)O)O[C@@H]4[C@H]([C@H]([C@@H]([C@H](O4)CO)O)OC(=O)N)O)C(=O)N[C@H](C)[C@H]([C@H](C)C(=O)N[C@@H]([C@@H](C)O)C(=O)NCCC5=NC(=CS5)C6=NC(=CS6)C(=O)NCCC[S+](C)C)O | StdInChI_Ref =  YaY | StdInChI = 1S/C55H83N17O21S3/c1-20-33(69-46(72-44(20)58)25(12-31(57)76)64-13-24(56)45(59)82)50(86)71-35(41(26-14-61-19-65-26)91-54-43(39(80)37(78)29(15-73)90-54)92-53-40(81)42(93-55(60)88)38(79)30(16-74)89-53)51(87)66-22(3)36(77)21(2)47(83)70-34(23(4)75)49(85)63-10-8-32-67-28(18-94-32)52-68-27(17-95-52)48(84)62-9-7-11-96(5)6/h14,17-19,21-25,29-30,34-43,53-54,64,73-75,77-81H,7-13,15-16,56H2,1-6H3,(H13-,57,58,59,60,61,62,63,65,66,69,70,71,72,76,82,83,84,85,86,87,88)/p+1/t21-,22+,23+,24-,25-,29-,30+,34-,35-,36-,37+,38+,39-,40-,41?,42-,43-,53+,54-/m0/s1 | StdInChIKey_Ref =  YaY | StdInChIKey = OYVAGSVQBOHSSS-QRQYLRPSSA-O }} Bleomisin adalah obat yang digunakan untuk mengobati kanker.[1] Termasuk diantaranya limfoma Hodgkin, limfoma non-Hodgkin, kanker testis, kanker ovarium, dan kanker serviks. Biasanya digunakan dengan obat kanker lainnya, obat ini dapat diberikan secara intravena, dengan injeksi ke dalam otot atau di bawah kulit.[1] Obat ini juga dapat diberikan dalam paru-paru untuk membantu mencegah munculnya cairan di sekitar paru-paru akibat kanker.[1][2]

Efek samping umumnya termasuk demam, penurunan berat badan, muntah, dan ruam. Anafilaksis dapat terjadi. Hal ini juga dapat menyebabkan radang paru-paru yang dapat mengakibatkan jaringan parut paru-paru. Sinar-X dada setiap beberapa minggu dianjurkan. Bleomisin dapat membahayakan bayi jika digunakan selama kehamilan. Bleomisin dipercaya bekerja dengan mencegah pembuatan DNA.[1]

Bleomisin ditemukan pada tahun 1962.[3] Obat ini termasuk dalam Daftar Obat Esensial Organisasi Kesehatan Dunia, daftar obat-obatan paling penting yang dibutuhkan pada sistem kesehatan dasar.[4] Obat ini tersedia sebagai obat generik.[1] Biaya grosir obat ini di negara berkembang antara USD 14-78 per dosis.[5] Obat ini dibuat oleh bakteri Streptomyces verticillus.[1]

Referensi[sunting | sunting sumber]

  1. ^ a b c d e f "Bleomycin Sulfate". The American Society of Health-System Pharmacists. Diakses tanggal Aug 1, 2015. 
  2. ^ Shaw, P; Agarwal, R (2004). "Pleurodesis for malignant pleural effusions". The Cochrane database of systematic reviews (1): CD002916. doi:10.1002/14651858.CD002916.pub2. PMID 14973997. 
  3. ^ Sneader, Walter (2005). Drug discovery : a history (edisi ke-Rev. and updated). Chichester: Wiley. hlm. 312. ISBN 9780471899792. 
  4. ^ "WHO Model List of EssentialMedicines" (PDF). World Health Organization. October 2013. Diakses tanggal 22 April 2014. 
  5. ^ "Bleomycin". International Drug Price Indicator Guide. Diakses tanggal 26 August 2015. 

Bacaan lebih lanjut[sunting | sunting sumber]

  • Claussen, C.A.; Long, E.C. (1999). "Nucleic Acid Recognition by Metal Complexes of Bleomycin". Chem. Rev. 99 (9): 2797–2816. doi:10.1021/cr980449z. PMID 11749501. 
  • Shen, B.; Du, L.C.; Sanchez, C.; Edwards, D.J.; Chen, M.; Murrell, J.M. (2001). "The biosynthetic gene cluster for the anticancer drug bleomycin from Streptomyces verticillus ATCC15003 as a model for hybrid peptide-polyketide natural product biosynthesis". Journal of Industrial Microbiology & Biotechnology. 27 (6): 378–385. doi:10.1038/sj.jim.7000194. PMID 11774003.