Litium bis(trimetilsilil)amida

Dari Wikipedia bahasa Indonesia, ensiklopedia bebas
Langsung ke: navigasi, cari
Litium bis(trimetilsilil)amida
Gambar
Identifikasi
Nomor CAS [4039-32-1]
SMILES C[Si](C)(C)[N-][Si](C)(C)C.[Li+]
Sifat
Rumus molekul C6H18LiNSi2
Massa molar 167,326 g/mol
Bahaya
Bahaya utama mudah terbakar
Senyawa terkait
Senyawa terkait Natrium bis(trimetilsilil)amida, Kalium bis(trimetilsilil)amida
Kecuali dinyatakan sebaliknya, data di atas berlaku
pada temperatur dan tekanan standar (25°C, 100 kPa)

Sangkalan dan referensi

Litium bis(trimetilsilil)amida adalah senyawa kimia dengan rumus ((CH3)3Si)2NLi. Senyawa ini, sering disebut sebagai litium heksametildisilazida atau LiHMDS adalah basa kuat yang digunakan untuk reaksi deprotonasi.

Lihat pula[sunting | sunting sumber]