Dimetilalil Pirofosfat

Dari Wikipedia bahasa Indonesia, ensiklopedia bebas
Langsung ke: navigasi, cari
Dimetilalil Pirofosfat
Gambar
Gambar
Identifikasi
Nomor CAS [358-72-5]
PubChem 647
MeSH 3,3-dimethylallyl+pyrophosphate
SMILES CC(=CCOP(=O)(O)OP(=O)(O)O)C
InChI 1/C20H36O7P2/c1-13-17(5,6)23-28(21,24-18(7,8)14-2)27-29(22,25-19(9,10)15-3)26-20(11,12)16-4/h13-16H,1-4H2,5-12H3
Sifat
Rumus molekul C5H12O7P2
Kecuali dinyatakan sebaliknya, data di atas berlaku
pada temperatur dan tekanan standar (25°C, 100 kPa)

Sangkalan dan referensi

Dimetilalil Pirofosfat (DMAPP) adalah intermediat dalam biosintesis senyawa-senyawa terpena. DMAPP adalah isomer dari IPP. DMAPP bersama IPP adalah C-5, isoprena aktif yang membuktikan bahwa senyawa-senyawa terpena adalah senyawa dengan jumlah karbon kelipatan lima.